C26H34O7 — CID 89257970
prop-2-enyl (E)-4-[(9E)-16-methoxy-6-(methoxymethoxy)-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]but-2-enoate (PubChem CID 89257970) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is prop-2-enyl (E)-4-[(9E)-16-methoxy-6-(methoxymethoxy)-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]but-2-enoate.
| Compound Name | prop-2-enyl (E)-4-[(9E)-16-methoxy-6-(methoxymethoxy)-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 89257970 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | prop-2-enyl (E)-4-[(9E)-16-methoxy-6-(methoxymethoxy)-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]but-2-enoate |
| SMILES | C=CCOC(=O)/C=C/CC1CC(OCOC)C(C)C/C=C/Cc2cccc(OC)c2C(=O)O1 |
| InChI | InChI=1S/C26H34O7/c1-5-16-31-24(27)15-9-13-21-17-23(32-18-29-3)19(2)10-6-7-11-20-12-8-14-22(30-4)25(20)26(28)33-21/h5-9,12,14-15,19,21,23H,1,10-11,13,16-18H2,2-4H3/b7-6+,15-9+ |
| InChIKey | MLLQAOOPBFZPDK-YSLZEPIFSA-N |
| XLogP | 4.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|