About 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane
3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane (PubChem CID 89258092) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane.
Analyze 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane?
The IUPAC name of 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane (CID 89258092) is 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane.
What is the SMILES notation for 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane?
The canonical SMILES for 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane is CC1C2NC3C(C)C(C3C)C1C2C.
What is the InChIKey of 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane?
The InChIKey is SHYKQTDPFYRDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-5-9-6(2)11(5)13-12-7(3)10(9)8(12)4/h5-13H,1-4H3.
What are the key properties of 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane?
3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane has a molecular weight of 179.31 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7,8,9-tetramethyl-5-azatricyclo[4.1.1.12,4]nonane is sourced from PubChem (CID 89258092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).