C27H37N11O3 — CID 89258254
2-N-(2-ethylhexyl)-4-N-[3-[N-methyl-4-[(2-nitro-4-nitrosophenyl)diazenyl]anilino]propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 89258254) has the molecular formula C27H37N11O3 and a molecular weight of 563.67 g/mol. Its IUPAC name is 2-N-(2-ethylhexyl)-4-N-[3-[N-methyl-4-[(2-nitro-4-nitrosophenyl)diazenyl]anilino]propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2-ethylhexyl)-4-N-[3-[N-methyl-4-[(2-nitro-4-nitrosophenyl)diazenyl]anilino]propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 89258254 |
| Molecular Formula | C27H37N11O3 |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | 2-N-(2-ethylhexyl)-4-N-[3-[N-methyl-4-[(2-nitro-4-nitrosophenyl)diazenyl]anilino]propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCC(CC)CNc1nc(N)nc(NCCCN(C)c2ccc(/N=N/c3ccc(N=O)cc3[N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C27H37N11O3/c1-4-6-8-19(5-2)18-30-27-32-25(28)31-26(33-27)29-15-7-16-37(3)22-12-9-20(10-13-22)34-35-23-14-11-21(36-39)17-24(23)38(40)41/h9-14,17,19H,4-8,15-16,18H2,1-3H3,(H4,28,29,30,31,32,33)/b35-34+ |
| InChIKey | HNHFHBLQEDUHTC-XAHDOWKMSA-N |
| XLogP | 6.74 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|