C32H31N3 — CID 89258270
N-[4-[N-(N-cyclohexa-1,5-dien-1-ylanilino)-C-methylcarbonimidoyl]cyclohexa-1,3-dien-1-yl]-N-phenylaniline (PubChem CID 89258270) has the molecular formula C32H31N3 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[4-[N-(N-cyclohexa-1,5-dien-1-ylanilino)-C-methylcarbonimidoyl]cyclohexa-1,3-dien-1-yl]-N-phenylaniline.
| Compound Name | N-[4-[N-(N-cyclohexa-1,5-dien-1-ylanilino)-C-methylcarbonimidoyl]cyclohexa-1,3-dien-1-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 89258270 |
| Molecular Formula | C32H31N3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[4-[N-(N-cyclohexa-1,5-dien-1-ylanilino)-C-methylcarbonimidoyl]cyclohexa-1,3-dien-1-yl]-N-phenylaniline |
| SMILES | CC(=NN(C1=CCCC=C1)c1ccccc1)C1=CC=C(N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H31N3/c1-26(33-35(31-18-10-4-11-19-31)32-20-12-5-13-21-32)27-22-24-30(25-23-27)34(28-14-6-2-7-15-28)29-16-8-3-9-17-29/h2-4,6-12,14-22,24H,5,13,23,25H2,1H3 |
| InChIKey | OJAYHQDLLJLUKU-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|