About 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione
6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 89258298) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione.
Molecular Properties
| Compound Name | 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione |
| PubChem CID | 89258298 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | O=C1NC(=O)C2CCC=C12 |
| InChI | InChI=1S/C7H7NO2/c9-6-4-2-1-3-5(4)7(10)8-6/h2,5H,1,3H2,(H,8,9,10) |
| InChIKey | FTINHKAOZHSUDN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione?
The IUPAC name of 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione (CID 89258298) is 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione.
What is the SMILES notation for 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione?
The canonical SMILES for 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione is O=C1NC(=O)C2CCC=C12.
What is the InChIKey of 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione?
The InChIKey is FTINHKAOZHSUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-6-4-2-1-3-5(4)7(10)8-6/h2,5H,1,3H2,(H,8,9,10).
What are the key properties of 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione?
6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione has a molecular weight of 137.14 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6a-dihydro-5H-cyclopenta[c]pyrrole-1,3-dione is sourced from PubChem (CID 89258298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).