About 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine
2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine (PubChem CID 89258439) has the molecular formula C12H9ClF2N2O3S
and a molecular weight of 334.73 g/mol. Its IUPAC name is 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine.
Molecular Properties
| Compound Name | 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine |
| PubChem CID | 89258439 |
| Molecular Formula | C12H9ClF2N2O3S |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine |
| SMILES | CS(=O)(=O)c1ccc(OCc2cnc(Cl)cn2)c(F)c1F |
| InChI | InChI=1S/C12H9ClF2N2O3S/c1-21(18,19)9-3-2-8(11(14)12(9)15)20-6-7-4-17-10(13)5-16-7/h2-5H,6H2,1H3 |
| InChIKey | PVXMMOUKOUEOJH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine?
The IUPAC name of 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine (CID 89258439) is 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine.
What is the SMILES notation for 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine?
The canonical SMILES for 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine is CS(=O)(=O)c1ccc(OCc2cnc(Cl)cn2)c(F)c1F.
What is the InChIKey of 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine?
The InChIKey is PVXMMOUKOUEOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF2N2O3S/c1-21(18,19)9-3-2-8(11(14)12(9)15)20-6-7-4-17-10(13)5-16-7/h2-5H,6H2,1H3.
What are the key properties of 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine?
2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine has a molecular weight of 334.73 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(2,3-difluoro-4-methylsulfonylphenoxy)methyl]pyrazine is sourced from PubChem (CID 89258439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).