C3H5N3OS3 — CID 89258503
1,3,5-triazinane-2,4,6-trithione;hydrate (PubChem CID 89258503) has the molecular formula C3H5N3OS3 and a molecular weight of 195.29 g/mol. Its IUPAC name is 1,3,5-triazinane-2,4,6-trithione;hydrate.
| Compound Name | 1,3,5-triazinane-2,4,6-trithione;hydrate |
|---|---|
| PubChem CID | 89258503 |
| Molecular Formula | C3H5N3OS3 |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 194.96 |
| IUPAC Name | 1,3,5-triazinane-2,4,6-trithione;hydrate |
| SMILES | O.S=c1[nH]c(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C3H3N3S3.H2O/c7-1-4-2(8)6-3(9)5-1;/h(H3,4,5,6,7,8,9);1H2 |
| InChIKey | MVBRKDXMSCBFBE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|