C23H44N4O2 — CID 89258530
N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 89258530) has the molecular formula C23H44N4O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 89258530 |
| Molecular Formula | C23H44N4O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC1(C)CC(N(C=O)CCCN(C=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H44N4O2/c1-20(2)12-18(13-21(3,4)24-20)26(16-28)10-9-11-27(17-29)19-14-22(5,6)25-23(7,8)15-19/h16-19,24-25H,9-15H2,1-8H3 |
| InChIKey | WAUFJNDIEZQEGL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|