About 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine
3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine (PubChem CID 89258548) has the molecular formula C8H9FN4O
and a molecular weight of 196.19 g/mol. Its IUPAC name is 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine.
Molecular Properties
| Compound Name | 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine |
| PubChem CID | 89258548 |
| Molecular Formula | C8H9FN4O |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine |
| SMILES | Nn1nc(OCCF)c2cccnc21 |
| InChI | InChI=1S/C8H9FN4O/c9-3-5-14-8-6-2-1-4-11-7(6)13(10)12-8/h1-2,4H,3,5,10H2 |
| InChIKey | HLLJTFLQBJFAKM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine?
The IUPAC name of 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine (CID 89258548) is 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine.
What is the SMILES notation for 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine?
The canonical SMILES for 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine is Nn1nc(OCCF)c2cccnc21.
What is the InChIKey of 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine?
The InChIKey is HLLJTFLQBJFAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN4O/c9-3-5-14-8-6-2-1-4-11-7(6)13(10)12-8/h1-2,4H,3,5,10H2.
What are the key properties of 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine?
3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine has a molecular weight of 196.19 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluoroethoxy)pyrazolo[5,4-b]pyridin-1-amine is sourced from PubChem (CID 89258548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).