C24H25F3IN3OS — CID 89258556
2-[(2,4-dimethyl-1,3-thiazol-5-yl)-[1-iodo-3-[4-(trifluoromethyl)phenyl]propyl]amino]-N-methyl-2-phenylacetamide (PubChem CID 89258556) has the molecular formula C24H25F3IN3OS and a molecular weight of 587.45 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-1,3-thiazol-5-yl)-[1-iodo-3-[4-(trifluoromethyl)phenyl]propyl]amino]-N-methyl-2-phenylacetamide.
| Compound Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)-[1-iodo-3-[4-(trifluoromethyl)phenyl]propyl]amino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 89258556 |
| Molecular Formula | C24H25F3IN3OS |
| Molecular Weight | 587.45 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)-[1-iodo-3-[4-(trifluoromethyl)phenyl]propyl]amino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)C(c1ccccc1)N(c1sc(C)nc1C)C(I)CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F3IN3OS/c1-15-23(33-16(2)30-15)31(21(22(32)29-3)18-7-5-4-6-8-18)20(28)14-11-17-9-12-19(13-10-17)24(25,26)27/h4-10,12-13,20-21H,11,14H2,1-3H3,(H,29,32) |
| InChIKey | HMPJYWOWLIIHMX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|