C22H34N4O10 — CID 89258636
tert-butyl N-[4-[[(S)-[(2R,3R,4S)-3-acetamido-4-amino-6-formyl-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]carbonylamino]butyl]carbamate (PubChem CID 89258636) has the molecular formula C22H34N4O10 and a molecular weight of 514.53 g/mol. Its IUPAC name is tert-butyl N-[4-[[(S)-[(2R,3R,4S)-3-acetamido-4-amino-6-formyl-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]carbonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(S)-[(2R,3R,4S)-3-acetamido-4-amino-6-formyl-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]carbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 89258636 |
| Molecular Formula | C22H34N4O10 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | tert-butyl N-[4-[[(S)-[(2R,3R,4S)-3-acetamido-4-amino-6-formyl-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]carbonylamino]butyl]carbamate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](OC(=O)NCCCCNC(=O)OC(C)(C)C)[C@H]2COC(=O)O2)OC(C=O)=C[C@@H]1N |
| InChI | InChI=1S/C22H34N4O10/c1-12(28)26-16-14(23)9-13(10-27)33-18(16)17(15-11-32-21(31)34-15)35-19(29)24-7-5-6-8-25-20(30)36-22(2,3)4/h9-10,14-18H,5-8,11,23H2,1-4H3,(H,24,29)(H,25,30)(H,26,28)/t14-,15+,16+,17+,18+/m0/s1 |
| InChIKey | KRAGUSUTLDNHQR-YYWYGQEZSA-N |
| XLogP | 0.24 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|