C15H20O2S — CID 89258879
2-methyl-6-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfonylcyclohexa-1,3-diene (PubChem CID 89258879) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-methyl-6-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfonylcyclohexa-1,3-diene.
| Compound Name | 2-methyl-6-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89258879 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-methyl-6-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfonylcyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C/CC)S(=O)(=O)C1C=C(C)C=CC1 |
| InChI | InChI=1S/C15H20O2S/c1-4-6-10-14(8-5-2)18(16,17)15-11-7-9-13(3)12-15/h5-10,12,15H,2,4,11H2,1,3H3/b10-6-,14-8+ |
| InChIKey | ODCYJXXWIRZEJO-LVFXEAJCSA-N |
| XLogP | 3.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|