C12H15NO — CID 89258971
(2E,4Z)-1-(1,2-dihydropyridin-4-yl)-2-methylhexa-2,4-dien-1-one (PubChem CID 89258971) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (2E,4Z)-1-(1,2-dihydropyridin-4-yl)-2-methylhexa-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-(1,2-dihydropyridin-4-yl)-2-methylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 89258971 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2E,4Z)-1-(1,2-dihydropyridin-4-yl)-2-methylhexa-2,4-dien-1-one |
| SMILES | C/C=C\C=C(/C)C(=O)C1=CCNC=C1 |
| InChI | InChI=1S/C12H15NO/c1-3-4-5-10(2)12(14)11-6-8-13-9-7-11/h3-8,13H,9H2,1-2H3/b4-3-,10-5+ |
| InChIKey | WEJQWEHGYNKHNF-DXWLQBKVSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|