C24H25ClO5 — CID 89259063
5-[(2S,4S)-2-(2-chlorophenyl)-4-(2-prop-1-en-2-yloxyphenyl)-1,3-dioxan-5-yl]pent-4-enoic acid (PubChem CID 89259063) has the molecular formula C24H25ClO5 and a molecular weight of 428.91 g/mol. Its IUPAC name is 5-[(2S,4S)-2-(2-chlorophenyl)-4-(2-prop-1-en-2-yloxyphenyl)-1,3-dioxan-5-yl]pent-4-enoic acid.
| Compound Name | 5-[(2S,4S)-2-(2-chlorophenyl)-4-(2-prop-1-en-2-yloxyphenyl)-1,3-dioxan-5-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 89259063 |
| Molecular Formula | C24H25ClO5 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 5-[(2S,4S)-2-(2-chlorophenyl)-4-(2-prop-1-en-2-yloxyphenyl)-1,3-dioxan-5-yl]pent-4-enoic acid |
| SMILES | C=C(C)Oc1ccccc1[C@H]1O[C@@H](c2ccccc2Cl)OCC1C=CCCC(=O)O |
| InChI | InChI=1S/C24H25ClO5/c1-16(2)29-21-13-7-5-11-19(21)23-17(9-3-8-14-22(26)27)15-28-24(30-23)18-10-4-6-12-20(18)25/h3-7,9-13,17,23-24H,1,8,14-15H2,2H3,(H,26,27)/t17?,23-,24-/m0/s1 |
| InChIKey | XEBNTTABALCXSC-BLFAFILHSA-N |
| XLogP | 6.08 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|