C10H9ClN2 — CID 89259359
6-chloro-4-methylidene-3H-quinolin-2-amine (PubChem CID 89259359) has the molecular formula C10H9ClN2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 6-chloro-4-methylidene-3H-quinolin-2-amine.
| Compound Name | 6-chloro-4-methylidene-3H-quinolin-2-amine |
|---|---|
| PubChem CID | 89259359 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-chloro-4-methylidene-3H-quinolin-2-amine |
| SMILES | C=C1CC(N)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H9ClN2/c1-6-4-10(12)13-9-3-2-7(11)5-8(6)9/h2-3,5H,1,4H2,(H2,12,13) |
| InChIKey | AFBUZTCSNONUJF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |