C20H26F4O — CID 89259496
6-[(1Z,5Z,7Z)-9-fluoro-7-methyl-3-methylidenedeca-1,5,7-trienyl]-3,5-dimethyl-2-(trifluoromethyl)-3,4-dihydro-2H-pyran (PubChem CID 89259496) has the molecular formula C20H26F4O and a molecular weight of 358.42 g/mol. Its IUPAC name is 6-[(1Z,5Z,7Z)-9-fluoro-7-methyl-3-methylidenedeca-1,5,7-trienyl]-3,5-dimethyl-2-(trifluoromethyl)-3,4-dihydro-2H-pyran.
| Compound Name | 6-[(1Z,5Z,7Z)-9-fluoro-7-methyl-3-methylidenedeca-1,5,7-trienyl]-3,5-dimethyl-2-(trifluoromethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 89259496 |
| Molecular Formula | C20H26F4O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 6-[(1Z,5Z,7Z)-9-fluoro-7-methyl-3-methylidenedeca-1,5,7-trienyl]-3,5-dimethyl-2-(trifluoromethyl)-3,4-dihydro-2H-pyran |
| SMILES | C=C(/C=C\C1=C(C)CC(C)C(C(F)(F)F)O1)C/C=C\C(C)=C/C(C)F |
| InChI | InChI=1S/C20H26F4O/c1-13(7-6-8-14(2)11-17(5)21)9-10-18-15(3)12-16(4)19(25-18)20(22,23)24/h6,8-11,16-17,19H,1,7,12H2,2-5H3/b8-6-,10-9-,14-11- |
| InChIKey | VVMAAOGVNFYAHT-VCXOSQJCSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|