About 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene
5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene (PubChem CID 89259519) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene |
| PubChem CID | 89259519 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene |
| SMILES | CC#CC1=CCC(C(C)(F)F)C=C1 |
| InChI | InChI=1S/C11H12F2/c1-3-4-9-5-7-10(8-6-9)11(2,12)13/h5-7,10H,8H2,1-2H3 |
| InChIKey | PGCHTZJUYJVVKR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene?
The IUPAC name of 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene (CID 89259519) is 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene.
What is the SMILES notation for 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene?
The canonical SMILES for 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene is CC#CC1=CCC(C(C)(F)F)C=C1.
What is the InChIKey of 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene?
The InChIKey is PGCHTZJUYJVVKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2/c1-3-4-9-5-7-10(8-6-9)11(2,12)13/h5-7,10H,8H2,1-2H3.
What are the key properties of 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene?
5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene has a molecular weight of 182.21 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-2-prop-1-ynylcyclohexa-1,3-diene is sourced from PubChem (CID 89259519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).