C19H19F7O2 — CID 89259538
4-[(1E)-1-fluoro-3-[(2Z,4Z)-1,1,3-trifluoro-2,5-dimethylhepta-2,4,6-trienoxy]buta-1,3-dienyl]-2-(trifluoromethyl)-3,6-dihydro-2H-pyran (PubChem CID 89259538) has the molecular formula C19H19F7O2 and a molecular weight of 412.35 g/mol. Its IUPAC name is 4-[(1E)-1-fluoro-3-[(2Z,4Z)-1,1,3-trifluoro-2,5-dimethylhepta-2,4,6-trienoxy]buta-1,3-dienyl]-2-(trifluoromethyl)-3,6-dihydro-2H-pyran.
| Compound Name | 4-[(1E)-1-fluoro-3-[(2Z,4Z)-1,1,3-trifluoro-2,5-dimethylhepta-2,4,6-trienoxy]buta-1,3-dienyl]-2-(trifluoromethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 89259538 |
| Molecular Formula | C19H19F7O2 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[(1E)-1-fluoro-3-[(2Z,4Z)-1,1,3-trifluoro-2,5-dimethylhepta-2,4,6-trienoxy]buta-1,3-dienyl]-2-(trifluoromethyl)-3,6-dihydro-2H-pyran |
| SMILES | C=C/C(C)=C\C(F)=C(/C)C(F)(F)OC(=C)/C=C(/F)C1=CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H19F7O2/c1-5-11(2)8-15(20)13(4)19(25,26)28-12(3)9-16(21)14-6-7-27-17(10-14)18(22,23)24/h5-6,8-9,17H,1,3,7,10H2,2,4H3/b11-8-,15-13-,16-9+ |
| InChIKey | SCESGZISYZHLNL-JWDWRVSOSA-N |
| XLogP | 6.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|