C20H26F2O — CID 89259546
2-[(4E,6E)-5,6-difluoronona-4,6,8-trienyl]-6-ethenyl-5-(2-methylprop-1-enyl)-3,4-dihydro-2H-pyran (PubChem CID 89259546) has the molecular formula C20H26F2O and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-[(4E,6E)-5,6-difluoronona-4,6,8-trienyl]-6-ethenyl-5-(2-methylprop-1-enyl)-3,4-dihydro-2H-pyran.
| Compound Name | 2-[(4E,6E)-5,6-difluoronona-4,6,8-trienyl]-6-ethenyl-5-(2-methylprop-1-enyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 89259546 |
| Molecular Formula | C20H26F2O |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[(4E,6E)-5,6-difluoronona-4,6,8-trienyl]-6-ethenyl-5-(2-methylprop-1-enyl)-3,4-dihydro-2H-pyran |
| SMILES | C=C/C=C(F)\C(F)=C/CCCC1CCC(C=C(C)C)=C(C=C)O1 |
| InChI | InChI=1S/C20H26F2O/c1-5-9-18(21)19(22)11-8-7-10-17-13-12-16(14-15(3)4)20(6-2)23-17/h5-6,9,11,14,17H,1-2,7-8,10,12-13H2,3-4H3/b18-9+,19-11+ |
| InChIKey | LXMOGWIBOUZOOW-ZYCAGONGSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|