About (3E)-4-chlorohexa-1,3,5-trien-2-ol
(3E)-4-chlorohexa-1,3,5-trien-2-ol (PubChem CID 89259712) has the molecular formula C6H7ClO
and a molecular weight of 130.57 g/mol. Its IUPAC name is (3E)-4-chlorohexa-1,3,5-trien-2-ol.
Molecular Properties
| Compound Name | (3E)-4-chlorohexa-1,3,5-trien-2-ol |
| PubChem CID | 89259712 |
| Molecular Formula | C6H7ClO |
| Molecular Weight | 130.57 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | (3E)-4-chlorohexa-1,3,5-trien-2-ol |
| SMILES | C=C/C(Cl)=C\C(=C)O |
| InChI | InChI=1S/C6H7ClO/c1-3-6(7)4-5(2)8/h3-4,8H,1-2H2/b6-4+ |
| InChIKey | GVGNGDVZGMFRSF-GQCTYLIASA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-chlorohexa-1,3,5-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-chlorohexa-1,3,5-trien-2-ol?
The IUPAC name of (3E)-4-chlorohexa-1,3,5-trien-2-ol (CID 89259712) is (3E)-4-chlorohexa-1,3,5-trien-2-ol.
What is the SMILES notation for (3E)-4-chlorohexa-1,3,5-trien-2-ol?
The canonical SMILES for (3E)-4-chlorohexa-1,3,5-trien-2-ol is C=C/C(Cl)=C\C(=C)O.
What is the InChIKey of (3E)-4-chlorohexa-1,3,5-trien-2-ol?
The InChIKey is GVGNGDVZGMFRSF-GQCTYLIASA-N. The full InChI is InChI=1S/C6H7ClO/c1-3-6(7)4-5(2)8/h3-4,8H,1-2H2/b6-4+.
What are the key properties of (3E)-4-chlorohexa-1,3,5-trien-2-ol?
(3E)-4-chlorohexa-1,3,5-trien-2-ol has a molecular weight of 130.57 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-chlorohexa-1,3,5-trien-2-ol is sourced from PubChem (CID 89259712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).