About (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol
(2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol (PubChem CID 89260219) has the molecular formula C8H13FO3
and a molecular weight of 176.19 g/mol. Its IUPAC name is (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol.
Molecular Properties
| Compound Name | (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol |
| PubChem CID | 89260219 |
| Molecular Formula | C8H13FO3 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](/C=C/CF)C(O)C1O |
| InChI | InChI=1S/C8H13FO3/c1-5-7(10)8(11)6(12-5)3-2-4-9/h2-3,5-8,10-11H,4H2,1H3/b3-2+/t5-,6+,7?,8?/m0/s1 |
| InChIKey | WAVBHSPCVCDLLN-YWNSZCJUSA-N |
| XLogP | 0.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol?
The IUPAC name of (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol (CID 89260219) is (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol.
What is the SMILES notation for (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol?
The canonical SMILES for (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol is C[C@@H]1O[C@H](/C=C/CF)C(O)C1O.
What is the InChIKey of (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol?
The InChIKey is WAVBHSPCVCDLLN-YWNSZCJUSA-N. The full InChI is InChI=1S/C8H13FO3/c1-5-7(10)8(11)6(12-5)3-2-4-9/h2-3,5-8,10-11H,4H2,1H3/b3-2+/t5-,6+,7?,8?/m0/s1.
What are the key properties of (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol?
(2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol has a molecular weight of 176.19 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-[(E)-3-fluoroprop-1-enyl]-5-methyloxolane-3,4-diol is sourced from PubChem (CID 89260219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).