C19H18BClN4O2 — CID 89260399
CID 89260399 (PubChem CID 89260399) has the molecular formula C19H18BClN4O2 and a molecular weight of 380.64 g/mol.
| Compound Name | CID 89260399 |
|---|---|
| PubChem CID | 89260399 |
| Molecular Formula | C19H18BClN4O2 |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc(OC)c2nc(Nc3ccc(C(=O)NC(C)C)cc3)ncc2c1Cl |
| InChI | InChI=1S/C19H18BClN4O2/c1-10(2)23-18(26)11-4-6-12(7-5-11)24-19-22-9-13-16(21)14(20)8-15(27-3)17(13)25-19/h4-10H,1-3H3,(H,23,26)(H,22,24,25) |
| InChIKey | MBZTWKMIEQFWHV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|