C10H15IN2O6 — CID 89260428
6-iodo-1-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione (PubChem CID 89260428) has the molecular formula C10H15IN2O6 and a molecular weight of 386.14 g/mol. Its IUPAC name is 6-iodo-1-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione.
| Compound Name | 6-iodo-1-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89260428 |
| Molecular Formula | C10H15IN2O6 |
| Molecular Weight | 386.14 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 6-iodo-1-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione |
| SMILES | CC(O[C@H](CO)C(O)CO)n1c(I)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15IN2O6/c1-5(19-7(4-15)6(16)3-14)13-8(11)2-9(17)12-10(13)18/h2,5-7,14-16H,3-4H2,1H3,(H,12,17,18)/t5?,6?,7-/m1/s1 |
| InChIKey | OIHRJJIWZJDTNE-KPGICGJXSA-N |
| XLogP | -1.61 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.14 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|