About (3-methoxycyclohexa-2,4-dien-1-yl)methanol
(3-methoxycyclohexa-2,4-dien-1-yl)methanol (PubChem CID 89260651) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (3-methoxycyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (3-methoxycyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 89260651 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3-methoxycyclohexa-2,4-dien-1-yl)methanol |
| SMILES | COC1=CC(CO)CC=C1 |
| InChI | InChI=1S/C8H12O2/c1-10-8-4-2-3-7(5-8)6-9/h2,4-5,7,9H,3,6H2,1H3 |
| InChIKey | HDOBVHNMNPQUOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methoxycyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxycyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (3-methoxycyclohexa-2,4-dien-1-yl)methanol (CID 89260651) is (3-methoxycyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (3-methoxycyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (3-methoxycyclohexa-2,4-dien-1-yl)methanol is COC1=CC(CO)CC=C1.
What is the InChIKey of (3-methoxycyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is HDOBVHNMNPQUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-10-8-4-2-3-7(5-8)6-9/h2,4-5,7,9H,3,6H2,1H3.
What are the key properties of (3-methoxycyclohexa-2,4-dien-1-yl)methanol?
(3-methoxycyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 140.18 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxycyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 89260651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).