C20H23F2NO6 — CID 89260777
(2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89260777) has the molecular formula C20H23F2NO6 and a molecular weight of 411.40 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89260777 |
| Molecular Formula | C20H23F2NO6 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H23F2NO6/c21-20(22)28-13-4-1-10(2-5-13)7-12-8-11(3-6-14(12)23)19-18(27)17(26)16(25)15(9-24)29-19/h1-6,8,15-20,24-27H,7,9,23H2/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | LHNVEHPJMUYVDB-FQBWVUSXSA-N |
| XLogP | 0.98 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|