C20H23F2NO5 — CID 89261028
(3R,4R,5S,6R)-2-[4-amino-3-[(2,6-difluoro-4-methylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89261028) has the molecular formula C20H23F2NO5 and a molecular weight of 395.40 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[4-amino-3-[(2,6-difluoro-4-methylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[4-amino-3-[(2,6-difluoro-4-methylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89261028 |
| Molecular Formula | C20H23F2NO5 |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3R,4R,5S,6R)-2-[4-amino-3-[(2,6-difluoro-4-methylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(F)c(Cc2cc(C3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2N)c(F)c1 |
| InChI | InChI=1S/C20H23F2NO5/c1-9-4-13(21)12(14(22)5-9)7-11-6-10(2-3-15(11)23)20-19(27)18(26)17(25)16(8-24)28-20/h2-6,16-20,24-27H,7-8,23H2,1H3/t16-,17-,18+,19?,20?/m1/s1 |
| InChIKey | BWUDCKWOQLXJBN-UYUJGIFYSA-N |
| XLogP | 0.96 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|