C21H25F2NO6 — CID 89261029
(2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethoxy-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89261029) has the molecular formula C21H25F2NO6 and a molecular weight of 425.43 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethoxy-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethoxy-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89261029 |
| Molecular Formula | C21H25F2NO6 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethoxy-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1cc(F)c(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2N)c(F)c1 |
| InChI | InChI=1S/C21H25F2NO6/c1-2-29-12-7-14(22)13(15(23)8-12)6-11-5-10(3-4-16(11)24)21-20(28)19(27)18(26)17(9-25)30-21/h3-5,7-8,17-21,25-28H,2,6,9,24H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | QHFPYIDKQDJOGC-ADAARDCZSA-N |
| XLogP | 1.05 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|