C20H23F2NO6 — CID 89261032
(2S,3R,4R,5S,6R)-2-[4-amino-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89261032) has the molecular formula C20H23F2NO6 and a molecular weight of 411.40 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-amino-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89261032 |
| Molecular Formula | C20H23F2NO6 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2N)c(F)c1F |
| InChI | InChI=1S/C20H23F2NO6/c1-28-13-5-3-9(15(21)16(13)22)6-11-7-10(2-4-12(11)23)20-19(27)18(26)17(25)14(8-24)29-20/h2-5,7,14,17-20,24-27H,6,8,23H2,1H3/t14-,17-,18+,19?,20+/m1/s1 |
| InChIKey | RBQXEKFPXSUQAK-YSXQTRAESA-N |
| XLogP | 0.66 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|