C12H14OS — CID 89261105
2,3-bis(ethenyl)-2,3,6,7-tetrahydro-1,4-benzoxathiine (PubChem CID 89261105) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-2,3,6,7-tetrahydro-1,4-benzoxathiine.
| Compound Name | 2,3-bis(ethenyl)-2,3,6,7-tetrahydro-1,4-benzoxathiine |
|---|---|
| PubChem CID | 89261105 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,3-bis(ethenyl)-2,3,6,7-tetrahydro-1,4-benzoxathiine |
| SMILES | C=CC1OC2=CCCC=C2SC1C=C |
| InChI | InChI=1S/C12H14OS/c1-3-9-11(4-2)14-12-8-6-5-7-10(12)13-9/h3-4,7-9,11H,1-2,5-6H2 |
| InChIKey | XTBASEROXWQDEL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|