C15H17NO6 — CID 89261224
(E)-3-[5-(hydroxymethyl)-2-(3-oxobutoxycarbonylamino)phenyl]prop-2-enoic acid (PubChem CID 89261224) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is (E)-3-[5-(hydroxymethyl)-2-(3-oxobutoxycarbonylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(hydroxymethyl)-2-(3-oxobutoxycarbonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89261224 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (E)-3-[5-(hydroxymethyl)-2-(3-oxobutoxycarbonylamino)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)CCOC(=O)Nc1ccc(CO)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H17NO6/c1-10(18)6-7-22-15(21)16-13-4-2-11(9-17)8-12(13)3-5-14(19)20/h2-5,8,17H,6-7,9H2,1H3,(H,16,21)(H,19,20)/b5-3+ |
| InChIKey | OQLJDTOGRASFRS-HWKANZROSA-N |
| XLogP | 1.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|