About [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol
[(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol (PubChem CID 89261501) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol |
| PubChem CID | 89261501 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol |
| SMILES | C=C/C=C\C(=C/C)CN1CCO[C@H](CO)C1 |
| InChI | InChI=1S/C13H21NO2/c1-3-5-6-12(4-2)9-14-7-8-16-13(10-14)11-15/h3-6,13,15H,1,7-11H2,2H3/b6-5-,12-4+/t13-/m0/s1 |
| InChIKey | DOFFRHMZTQYBGI-AJZVUWHRSA-N |
| XLogP | 1.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol?
The IUPAC name of [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol (CID 89261501) is [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol.
What is the SMILES notation for [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol?
The canonical SMILES for [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol is C=C/C=C\C(=C/C)CN1CCO[C@H](CO)C1.
What is the InChIKey of [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol?
The InChIKey is DOFFRHMZTQYBGI-AJZVUWHRSA-N. The full InChI is InChI=1S/C13H21NO2/c1-3-5-6-12(4-2)9-14-7-8-16-13(10-14)11-15/h3-6,13,15H,1,7-11H2,2H3/b6-5-,12-4+/t13-/m0/s1.
What are the key properties of [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol?
[(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol has a molecular weight of 223.32 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]morpholin-2-yl]methanol is sourced from PubChem (CID 89261501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).