About (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone
(3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone (PubChem CID 892616) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone |
| PubChem CID | 892616 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)n2cnnc2N)cc1 |
| InChI | InChI=1S/C10H10N4O/c1-7-2-4-8(5-3-7)9(15)14-6-12-13-10(14)11/h2-6H,1H3,(H2,11,13) |
| InChIKey | QXYXZOXEPMANBZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone?
The IUPAC name of (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone (CID 892616) is (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone.
What is the SMILES notation for (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone?
The canonical SMILES for (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone is Cc1ccc(C(=O)n2cnnc2N)cc1.
What is the InChIKey of (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone?
The InChIKey is QXYXZOXEPMANBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c1-7-2-4-8(5-3-7)9(15)14-6-12-13-10(14)11/h2-6H,1H3,(H2,11,13).
What are the key properties of (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone?
(3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone has a molecular weight of 202.22 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-1,2,4-triazol-4-yl)-(4-methylphenyl)methanone is sourced from PubChem (CID 892616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).