About N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine
N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine (PubChem CID 89261738) has the molecular formula C17H12Cl2F2N4
and a molecular weight of 381.21 g/mol. Its IUPAC name is N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine |
| PubChem CID | 89261738 |
| Molecular Formula | C17H12Cl2F2N4 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine |
| SMILES | Cc1cc(Cl)ncc1-c1cnc(NCc2c(F)cc(Cl)cc2F)nc1 |
| InChI | InChI=1S/C17H12Cl2F2N4/c1-9-2-16(19)22-7-12(9)10-5-23-17(24-6-10)25-8-13-14(20)3-11(18)4-15(13)21/h2-7H,8H2,1H3,(H,23,24,25) |
| InChIKey | XEBPJLJFEYTPLW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine?
The IUPAC name of N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine (CID 89261738) is N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine.
What is the SMILES notation for N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine?
The canonical SMILES for N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine is Cc1cc(Cl)ncc1-c1cnc(NCc2c(F)cc(Cl)cc2F)nc1.
What is the InChIKey of N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine?
The InChIKey is XEBPJLJFEYTPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2F2N4/c1-9-2-16(19)22-7-12(9)10-5-23-17(24-6-10)25-8-13-14(20)3-11(18)4-15(13)21/h2-7H,8H2,1H3,(H,23,24,25).
What are the key properties of N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine?
N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine has a molecular weight of 381.21 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chloro-2,6-difluorophenyl)methyl]-5-(6-chloro-4-methyl-3-pyridinyl)pyrimidin-2-amine is sourced from PubChem (CID 89261738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).