About 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide
6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide (PubChem CID 89262065) has the molecular formula C17H16ClFN4O3
and a molecular weight of 378.79 g/mol. Its IUPAC name is 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide |
| PubChem CID | 89262065 |
| Molecular Formula | C17H16ClFN4O3 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)Nc2ccc([C@H]3CNCCO3)c(F)c2)cc(Cl)n1 |
| InChI | InChI=1S/C17H16ClFN4O3/c18-15-6-9(5-13(23-15)16(20)24)17(25)22-10-1-2-11(12(19)7-10)14-8-21-3-4-26-14/h1-2,5-7,14,21H,3-4,8H2,(H2,20,24)(H,22,25)/t14-/m1/s1 |
| InChIKey | YYAOHSXHVINJNK-CQSZACIVSA-N |
| XLogP | 1.89 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide?
The IUPAC name of 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide (CID 89262065) is 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide.
What is the SMILES notation for 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide?
The canonical SMILES for 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide is NC(=O)c1cc(C(=O)Nc2ccc([C@H]3CNCCO3)c(F)c2)cc(Cl)n1.
What is the InChIKey of 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide?
The InChIKey is YYAOHSXHVINJNK-CQSZACIVSA-N. The full InChI is InChI=1S/C17H16ClFN4O3/c18-15-6-9(5-13(23-15)16(20)24)17(25)22-10-1-2-11(12(19)7-10)14-8-21-3-4-26-14/h1-2,5-7,14,21H,3-4,8H2,(H2,20,24)(H,22,25)/t14-/m1/s1.
What are the key properties of 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide?
6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide has a molecular weight of 378.79 g/mol, XLogP of 1.89, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]pyridine-2,4-dicarboxamide is sourced from PubChem (CID 89262065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).