C15H20F2O2 — CID 89262489
2-[3-(3,5-difluorocyclohexa-1,5-dien-1-yl)propyl]-2-prop-2-enyl-1,3-dioxolane (PubChem CID 89262489) has the molecular formula C15H20F2O2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[3-(3,5-difluorocyclohexa-1,5-dien-1-yl)propyl]-2-prop-2-enyl-1,3-dioxolane.
| Compound Name | 2-[3-(3,5-difluorocyclohexa-1,5-dien-1-yl)propyl]-2-prop-2-enyl-1,3-dioxolane |
|---|---|
| PubChem CID | 89262489 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[3-(3,5-difluorocyclohexa-1,5-dien-1-yl)propyl]-2-prop-2-enyl-1,3-dioxolane |
| SMILES | C=CCC1(CCCC2=CC(F)CC(F)=C2)OCCO1 |
| InChI | InChI=1S/C15H20F2O2/c1-2-5-15(18-7-8-19-15)6-3-4-12-9-13(16)11-14(17)10-12/h2,9-10,13H,1,3-8,11H2 |
| InChIKey | RANUEHJVULKQKI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|