About 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol
2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol (PubChem CID 89262506) has the molecular formula C8H15N2O2+
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol |
| PubChem CID | 89262506 |
| Molecular Formula | C8H15N2O2+ |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol |
| SMILES | C=CC[N+]1(CC(O)O)C=NCC1 |
| InChI | InChI=1S/C8H15N2O2/c1-2-4-10(6-8(11)12)5-3-9-7-10/h2,7-8,11-12H,1,3-6H2/q+1 |
| InChIKey | PDQACVVTRHRIRU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol?
The IUPAC name of 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol (CID 89262506) is 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol.
What is the SMILES notation for 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol?
The canonical SMILES for 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol is C=CC[N+]1(CC(O)O)C=NCC1.
What is the InChIKey of 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol?
The InChIKey is PDQACVVTRHRIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2O2/c1-2-4-10(6-8(11)12)5-3-9-7-10/h2,7-8,11-12H,1,3-6H2/q+1.
What are the key properties of 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol?
2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol has a molecular weight of 171.22 g/mol, XLogP of -0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethane-1,1-diol is sourced from PubChem (CID 89262506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).