C33H53NS — CID 89263014
(7S,13Z)-7-(4-cyclohex-3-en-1-ylcyclohex-3-en-1-yl)sulfanyl-2-ethyl-13-methyl-5,8-dimethylidenehexadeca-13,15-dien-1-amine (PubChem CID 89263014) has the molecular formula C33H53NS and a molecular weight of 495.86 g/mol. Its IUPAC name is (7S,13Z)-7-(4-cyclohex-3-en-1-ylcyclohex-3-en-1-yl)sulfanyl-2-ethyl-13-methyl-5,8-dimethylidenehexadeca-13,15-dien-1-amine.
| Compound Name | (7S,13Z)-7-(4-cyclohex-3-en-1-ylcyclohex-3-en-1-yl)sulfanyl-2-ethyl-13-methyl-5,8-dimethylidenehexadeca-13,15-dien-1-amine |
|---|---|
| PubChem CID | 89263014 |
| Molecular Formula | C33H53NS |
| Molecular Weight | 495.86 g/mol |
| Exact Mass | 495.39 |
| IUPAC Name | (7S,13Z)-7-(4-cyclohex-3-en-1-ylcyclohex-3-en-1-yl)sulfanyl-2-ethyl-13-methyl-5,8-dimethylidenehexadeca-13,15-dien-1-amine |
| SMILES | C=C/C=C(/C)CCCCC(=C)[C@H](CC(=C)CCC(CC)CN)SC1CC=C(C2CC=CCC2)CC1 |
| InChI | InChI=1S/C33H53NS/c1-6-13-26(3)14-11-12-15-28(5)33(24-27(4)18-19-29(7-2)25-34)35-32-22-20-31(21-23-32)30-16-9-8-10-17-30/h6,8-9,13,20,29-30,32-33H,1,4-5,7,10-12,14-19,21-25,34H2,2-3H3/b26-13-/t29?,30?,32?,33-/m0/s1 |
| InChIKey | HUHCIBLISXMFQM-NINYKWEDSA-N |
| XLogP | 9.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.86 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|