About 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene
7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (PubChem CID 89263292) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
Molecular Properties
| Compound Name | 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| PubChem CID | 89263292 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| SMILES | CC1CC2=C1N=CC2 |
| InChI | InChI=1S/C7H9N/c1-5-4-6-2-3-8-7(5)6/h3,5H,2,4H2,1H3 |
| InChIKey | KQOVDNWPJWCGQM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The IUPAC name of 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (CID 89263292) is 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
What is the SMILES notation for 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The canonical SMILES for 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is CC1CC2=C1N=CC2.
What is the InChIKey of 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The InChIKey is KQOVDNWPJWCGQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-5-4-6-2-3-8-7(5)6/h3,5H,2,4H2,1H3.
What are the key properties of 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene has a molecular weight of 107.16 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is sourced from PubChem (CID 89263292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).