About (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene
(4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene (PubChem CID 89263316) has the molecular formula C8H11IO
and a molecular weight of 250.08 g/mol. Its IUPAC name is (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene.
Molecular Properties
| Compound Name | (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene |
| PubChem CID | 89263316 |
| Molecular Formula | C8H11IO |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene |
| SMILES | CC1C2=C(C1C)[C@H](I)CO2 |
| InChI | InChI=1S/C8H11IO/c1-4-5(2)8-7(4)6(9)3-10-8/h4-6H,3H2,1-2H3/t4?,5?,6-/m1/s1 |
| InChIKey | JCVYOASWQZZXRN-JMMWHDCWSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The IUPAC name of (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene (CID 89263316) is (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene.
What is the SMILES notation for (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The canonical SMILES for (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene is CC1C2=C(C1C)[C@H](I)CO2.
What is the InChIKey of (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The InChIKey is JCVYOASWQZZXRN-JMMWHDCWSA-N. The full InChI is InChI=1S/C8H11IO/c1-4-5(2)8-7(4)6(9)3-10-8/h4-6H,3H2,1-2H3/t4?,5?,6-/m1/s1.
What are the key properties of (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
(4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene has a molecular weight of 250.08 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-iodo-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene is sourced from PubChem (CID 89263316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).