About 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol
1-amino-7-methyl-6,7-dihydronaphthalen-2-ol (PubChem CID 89263459) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol |
| PubChem CID | 89263459 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol |
| SMILES | CC1C=c2c(N)c(O)ccc2=CC1 |
| InChI | InChI=1S/C11H13NO/c1-7-2-3-8-4-5-10(13)11(12)9(8)6-7/h3-7,13H,2,12H2,1H3 |
| InChIKey | HRUQCEMGKVHATB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol?
The IUPAC name of 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol (CID 89263459) is 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol.
What is the SMILES notation for 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol?
The canonical SMILES for 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol is CC1C=c2c(N)c(O)ccc2=CC1.
What is the InChIKey of 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol?
The InChIKey is HRUQCEMGKVHATB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7-2-3-8-4-5-10(13)11(12)9(8)6-7/h3-7,13H,2,12H2,1H3.
What are the key properties of 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol?
1-amino-7-methyl-6,7-dihydronaphthalen-2-ol has a molecular weight of 175.23 g/mol, XLogP of 0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-7-methyl-6,7-dihydronaphthalen-2-ol is sourced from PubChem (CID 89263459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).