About 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran
4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran (PubChem CID 89263498) has the molecular formula C8H14S
and a molecular weight of 142.27 g/mol. Its IUPAC name is 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran |
| PubChem CID | 89263498 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran |
| SMILES | CCC1=C(C)CSCC1 |
| InChI | InChI=1S/C8H14S/c1-3-8-4-5-9-6-7(8)2/h3-6H2,1-2H3 |
| InChIKey | ZKLMOYQBJXMTMU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran?
The IUPAC name of 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran (CID 89263498) is 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran is CCC1=C(C)CSCC1.
What is the InChIKey of 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran?
The InChIKey is ZKLMOYQBJXMTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S/c1-3-8-4-5-9-6-7(8)2/h3-6H2,1-2H3.
What are the key properties of 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran?
4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran has a molecular weight of 142.27 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-methyl-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 89263498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).