C16H15N3O6 — CID 8926353
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926353) has the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926353 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)N1CCNC1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H15N3O6/c1-9(15(23)25-8-12(20)18-7-6-17-16(18)24)19-13(21)10-4-2-3-5-11(10)14(19)22/h2-5,9H,6-8H2,1H3,(H,17,24)/t9-/m0/s1 |
| InChIKey | CWRDUQSFZBRLHS-VIFPVBQESA-N |
| XLogP | -0.23 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|