C21H27N3O3 — CID 89263732
N-cyclohexyl-2-[(E)-2-(2,3-dihydrofuran-5-yl)ethenyl]-7-(methylperoxymethyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 89263732) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-cyclohexyl-2-[(E)-2-(2,3-dihydrofuran-5-yl)ethenyl]-7-(methylperoxymethyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-cyclohexyl-2-[(E)-2-(2,3-dihydrofuran-5-yl)ethenyl]-7-(methylperoxymethyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 89263732 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-cyclohexyl-2-[(E)-2-(2,3-dihydrofuran-5-yl)ethenyl]-7-(methylperoxymethyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | COOCc1ccn2c(NC3CCCCC3)c(/C=C/C3=CCCO3)nc2c1 |
| InChI | InChI=1S/C21H27N3O3/c1-25-27-15-16-11-12-24-20(14-16)23-19(10-9-18-8-5-13-26-18)21(24)22-17-6-3-2-4-7-17/h8-12,14,17,22H,2-7,13,15H2,1H3/b10-9+ |
| InChIKey | LGAHHFWQXBPRIF-MDZDMXLPSA-N |
| XLogP | 4.47 |
| TPSA | 57.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|