C26H30N4O2 — CID 89263750
N-benzyl-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-7-(methylperoxymethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-amine (PubChem CID 89263750) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-benzyl-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-7-(methylperoxymethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-7-(methylperoxymethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 89263750 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-benzyl-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-7-(methylperoxymethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-amine |
| SMILES | COOCC1=CC2=NC(/C=C/c3ccc(N(C)C)cc3)C(NCc3ccccc3)N2C=C1 |
| InChI | InChI=1S/C26H30N4O2/c1-29(2)23-12-9-20(10-13-23)11-14-24-26(27-18-21-7-5-4-6-8-21)30-16-15-22(19-32-31-3)17-25(30)28-24/h4-17,24,26-27H,18-19H2,1-3H3/b14-11+ |
| InChIKey | OKPMGOMSKUPRBF-SDNWHVSQSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|