C21H36S — CID 89263790
(2Z,4E,6Z)-3,6,8-trimethyl-4-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)deca-2,4,6-triene (PubChem CID 89263790) has the molecular formula C21H36S and a molecular weight of 320.59 g/mol. Its IUPAC name is (2Z,4E,6Z)-3,6,8-trimethyl-4-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)deca-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-3,6,8-trimethyl-4-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)deca-2,4,6-triene |
|---|---|
| PubChem CID | 89263790 |
| Molecular Formula | C21H36S |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (2Z,4E,6Z)-3,6,8-trimethyl-4-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)deca-2,4,6-triene |
| SMILES | C/C=C(C)\C(=C/C(C)=C\C(C)CC)SC(=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H36S/c1-11-16(5)13-17(6)14-19(18(7)12-2)22-20(15(3)4)21(8,9)10/h12-14,16H,11H2,1-10H3/b17-13-,18-12-,19-14+ |
| InChIKey | CXBKLRKLEGVKGM-NBWYAYPPSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|