About 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene
5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene (PubChem CID 89263798) has the molecular formula C17H24S
and a molecular weight of 260.45 g/mol. Its IUPAC name is 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene.
Molecular Properties
| Compound Name | 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene |
| PubChem CID | 89263798 |
| Molecular Formula | C17H24S |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene |
| SMILES | C=CC(C/C=C(\C)C(C)C)C1=CC(=C)C(C=C)S1 |
| InChI | InChI=1S/C17H24S/c1-7-15(10-9-13(5)12(3)4)17-11-14(6)16(8-2)18-17/h7-9,11-12,15-16H,1-2,6,10H2,3-5H3/b13-9+ |
| InChIKey | BOFANNNMAXTCBB-UKTHLTGXSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene?
The IUPAC name of 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene (CID 89263798) is 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene.
What is the SMILES notation for 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene?
The canonical SMILES for 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene is C=CC(C/C=C(\C)C(C)C)C1=CC(=C)C(C=C)S1.
What is the InChIKey of 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene?
The InChIKey is BOFANNNMAXTCBB-UKTHLTGXSA-N. The full InChI is InChI=1S/C17H24S/c1-7-15(10-9-13(5)12(3)4)17-11-14(6)16(8-2)18-17/h7-9,11-12,15-16H,1-2,6,10H2,3-5H3/b13-9+.
What are the key properties of 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene?
5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene has a molecular weight of 260.45 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5E)-6,7-dimethylocta-1,5-dien-3-yl]-2-ethenyl-3-methylidenethiophene is sourced from PubChem (CID 89263798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).