About 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene
2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene (PubChem CID 89263865) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene.
Analyze 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene?
The IUPAC name of 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene (CID 89263865) is 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene.
What is the SMILES notation for 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene?
The canonical SMILES for 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene is CC1=NC2(C=CC=CC2)C=N1.
What is the InChIKey of 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene?
The InChIKey is OSARYXJEUACDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-8-10-7-9(11-8)5-3-2-4-6-9/h2-5,7H,6H2,1H3.
What are the key properties of 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene?
2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene has a molecular weight of 146.19 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-diazaspiro[4.5]deca-1,3,6,8-tetraene is sourced from PubChem (CID 89263865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).