C26H39N — CID 89264864
N-cyclohex-2-en-1-yl-N-cyclohex-3-en-1-yl-4-(6-methylhepta-1,5-dien-3-yl)cyclohex-3-en-1-amine (PubChem CID 89264864) has the molecular formula C26H39N and a molecular weight of 365.61 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-N-cyclohex-3-en-1-yl-4-(6-methylhepta-1,5-dien-3-yl)cyclohex-3-en-1-amine.
| Compound Name | N-cyclohex-2-en-1-yl-N-cyclohex-3-en-1-yl-4-(6-methylhepta-1,5-dien-3-yl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 89264864 |
| Molecular Formula | C26H39N |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | N-cyclohex-2-en-1-yl-N-cyclohex-3-en-1-yl-4-(6-methylhepta-1,5-dien-3-yl)cyclohex-3-en-1-amine |
| SMILES | C=CC(CC=C(C)C)C1=CCC(N(C2C=CCCC2)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C26H39N/c1-4-22(16-15-21(2)3)23-17-19-26(20-18-23)27(24-11-7-5-8-12-24)25-13-9-6-10-14-25/h4-5,7,9,13,15,17,22,24-26H,1,6,8,10-12,14,16,18-20H2,2-3H3 |
| InChIKey | KNHSAEFNEKNBSL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|