C10H14N2O — CID 89264896
6-methoxy-1,2,4a,8a-tetrahydroquinolin-8-amine (PubChem CID 89264896) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-methoxy-1,2,4a,8a-tetrahydroquinolin-8-amine.
| Compound Name | 6-methoxy-1,2,4a,8a-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 89264896 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-methoxy-1,2,4a,8a-tetrahydroquinolin-8-amine |
| SMILES | COC1=CC2C=CCNC2C(N)=C1 |
| InChI | InChI=1S/C10H14N2O/c1-13-8-5-7-3-2-4-12-10(7)9(11)6-8/h2-3,5-7,10,12H,4,11H2,1H3 |
| InChIKey | HRWKQZMTEGBZHP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|