About 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine
1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine (PubChem CID 89265369) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine.
Molecular Properties
| Compound Name | 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine |
| PubChem CID | 89265369 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine |
| SMILES | C[C@@H]1CC=C(N2CCNCC2)S1 |
| InChI | InChI=1S/C9H16N2S/c1-8-2-3-9(12-8)11-6-4-10-5-7-11/h3,8,10H,2,4-7H2,1H3/t8-/m1/s1 |
| InChIKey | DFZUEZWGPKYTHA-MRVPVSSYSA-N |
| XLogP | 1.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine?
The IUPAC name of 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine (CID 89265369) is 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine.
What is the SMILES notation for 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine?
The canonical SMILES for 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine is C[C@@H]1CC=C(N2CCNCC2)S1.
What is the InChIKey of 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine?
The InChIKey is DFZUEZWGPKYTHA-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-8-2-3-9(12-8)11-6-4-10-5-7-11/h3,8,10H,2,4-7H2,1H3/t8-/m1/s1.
What are the key properties of 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine?
1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine has a molecular weight of 184.31 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-methyl-2,3-dihydrothiophen-5-yl]piperazine is sourced from PubChem (CID 89265369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).